C15H16ClFN4 — CID 19624897
N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine (PubChem CID 19624897) has the molecular formula C15H16ClFN4 and a molecular weight of 306.77 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine.
| Compound Name | N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 19624897 |
| Molecular Formula | C15H16ClFN4 |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine |
| SMILES | Cn1ncc(Cl)c1CNCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C15H16ClFN4/c1-21-15(13(16)8-20-21)9-18-5-4-10-7-19-14-3-2-11(17)6-12(10)14/h2-3,6-8,18-19H,4-5,9H2,1H3 |
| InChIKey | NYUBPVQHYCFGFJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|