C15H26O7 — CID 23567721
14-hydroxy-1,4,7,10-tetraoxacyclononadecane-11,19-dione (PubChem CID 23567721) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is 14-hydroxy-1,4,7,10-tetraoxacyclononadecane-11,19-dione.
| Compound Name | 14-hydroxy-1,4,7,10-tetraoxacyclononadecane-11,19-dione |
|---|---|
| PubChem CID | 23567721 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 14-hydroxy-1,4,7,10-tetraoxacyclononadecane-11,19-dione |
| SMILES | O=C1CCCCC(O)CCC(=O)OCCOCCOCCO1 |
| InChI | InChI=1S/C15H26O7/c16-13-3-1-2-4-14(17)21-11-9-19-7-8-20-10-12-22-15(18)6-5-13/h13,16H,1-12H2 |
| InChIKey | IIYCDVSWLYEROP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |