C33H47FN4O2 — CID 23593652
N-[2-(dimethylamino)ethyl]-N-[1-[3-(4-fluorophenyl)-6,7,8-trimethyl-4-oxoquinazolin-2-yl]ethyl]decanamide (PubChem CID 23593652) has the molecular formula C33H47FN4O2 and a molecular weight of 550.76 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[1-[3-(4-fluorophenyl)-6,7,8-trimethyl-4-oxoquinazolin-2-yl]ethyl]decanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(4-fluorophenyl)-6,7,8-trimethyl-4-oxoquinazolin-2-yl]ethyl]decanamide |
|---|---|
| PubChem CID | 23593652 |
| Molecular Formula | C33H47FN4O2 |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(4-fluorophenyl)-6,7,8-trimethyl-4-oxoquinazolin-2-yl]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(CCN(C)C)C(C)c1nc2c(C)c(C)c(C)cc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C33H47FN4O2/c1-8-9-10-11-12-13-14-15-30(39)37(21-20-36(6)7)26(5)32-35-31-25(4)24(3)23(2)22-29(31)33(40)38(32)28-18-16-27(34)17-19-28/h16-19,22,26H,8-15,20-21H2,1-7H3 |
| InChIKey | VZXUDQNBLUREBZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|