C22H40N4O2Si — CID 23594085
4-cyano-N-[3-[2-[(4-cyano-4-methylpentanoyl)amino]propan-2-yl-dimethylsilyl]propyl]-4-methylpentanamide (PubChem CID 23594085) has the molecular formula C22H40N4O2Si and a molecular weight of 420.67 g/mol. Its IUPAC name is 4-cyano-N-[3-[2-[(4-cyano-4-methylpentanoyl)amino]propan-2-yl-dimethylsilyl]propyl]-4-methylpentanamide.
| Compound Name | 4-cyano-N-[3-[2-[(4-cyano-4-methylpentanoyl)amino]propan-2-yl-dimethylsilyl]propyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 23594085 |
| Molecular Formula | C22H40N4O2Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 4-cyano-N-[3-[2-[(4-cyano-4-methylpentanoyl)amino]propan-2-yl-dimethylsilyl]propyl]-4-methylpentanamide |
| SMILES | CC(C)(C#N)CCC(=O)NCCC[Si](C)(C)C(C)(C)NC(=O)CCC(C)(C)C#N |
| InChI | InChI=1S/C22H40N4O2Si/c1-20(2,16-23)12-10-18(27)25-14-9-15-29(7,8)22(5,6)26-19(28)11-13-21(3,4)17-24/h9-15H2,1-8H3,(H,25,27)(H,26,28) |
| InChIKey | DCVMXVANBPYXFC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|