C28H33NO2 — CID 23606947
1-(4-methoxyphenyl)-1-(3-methylphenyl)-2-phenyl-3-piperidin-1-ylpropan-1-ol (PubChem CID 23606947) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1-(3-methylphenyl)-2-phenyl-3-piperidin-1-ylpropan-1-ol.
| Compound Name | 1-(4-methoxyphenyl)-1-(3-methylphenyl)-2-phenyl-3-piperidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 23606947 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-(4-methoxyphenyl)-1-(3-methylphenyl)-2-phenyl-3-piperidin-1-ylpropan-1-ol |
| SMILES | COc1ccc(C(O)(c2cccc(C)c2)C(CN2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33NO2/c1-22-10-9-13-25(20-22)28(30,24-14-16-26(31-2)17-15-24)27(23-11-5-3-6-12-23)21-29-18-7-4-8-19-29/h3,5-6,9-17,20,27,30H,4,7-8,18-19,21H2,1-2H3 |
| InChIKey | MMTLGSHAAYMWPI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |