C18H25N3O5S — CID 2361226
3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 2361226) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2361226 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1cc(-c2nn(CN3C[C@H](C)O[C@@H](C)C3)c(=S)o2)cc(OC)c1OC |
| InChI | InChI=1S/C18H25N3O5S/c1-11-8-20(9-12(2)25-11)10-21-18(27)26-17(19-21)13-6-14(22-3)16(24-5)15(7-13)23-4/h6-7,11-12H,8-10H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | CLSPITKJKCEVNV-RYUDHWBXSA-N |
| XLogP | 2.97 |
| TPSA | 71.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|