About ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide
ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide (PubChem CID 23616875) has the molecular formula C10H17ClNO2-
and a molecular weight of 218.70 g/mol. Its IUPAC name is ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide.
Molecular Properties
| Compound Name | ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide |
| PubChem CID | 23616875 |
| Molecular Formula | C10H17ClNO2- |
| Molecular Weight | 218.70 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide |
| SMILES | CC[N+](C)(C)c1cccc(O)c1.[Cl-].[OH-] |
| InChI | InChI=1S/C10H15NO.ClH.H2O/c1-4-11(2,3)9-6-5-7-10(12)8-9;;/h5-8H,4H2,1-3H3;1H;1H2/p-1 |
| InChIKey | FHRZKPSRJRMBJA-UHFFFAOYSA-M |
| XLogP | -1.19 |
| TPSA | 50.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.70 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide?
The IUPAC name of ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide (CID 23616875) is ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide.
What is the SMILES notation for ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide?
The canonical SMILES for ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide is CC[N+](C)(C)c1cccc(O)c1.[Cl-].[OH-].
What is the InChIKey of ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide?
The InChIKey is FHRZKPSRJRMBJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H15NO.ClH.H2O/c1-4-11(2,3)9-6-5-7-10(12)8-9;;/h5-8H,4H2,1-3H3;1H;1H2/p-1.
What are the key properties of ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide?
ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide has a molecular weight of 218.70 g/mol, XLogP of -1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-(3-hydroxyphenyl)-dimethylazanium;chloride;hydroxide is sourced from PubChem (CID 23616875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).