C33H36F3NO5S2 — CID 23642965
N-[(1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-4-[(2R)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)butyl]-2,2,2-trifluoroacetamide (PubChem CID 23642965) has the molecular formula C33H36F3NO5S2 and a molecular weight of 647.78 g/mol. Its IUPAC name is N-[(1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-4-[(2R)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-4-[(2R)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 23642965 |
| Molecular Formula | C33H36F3NO5S2 |
| Molecular Weight | 647.78 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | N-[(1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-4-[(2R)-oxiran-2-yl]-2,3,4-tris(phenylmethoxy)butyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@H](C1SCCCS1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]1CO1)C(F)(F)F |
| InChI | InChI=1S/C33H36F3NO5S2/c34-33(35,36)32(38)37-27(31-43-17-10-18-44-31)29(41-20-24-13-6-2-7-14-24)30(42-21-25-15-8-3-9-16-25)28(26-22-39-26)40-19-23-11-4-1-5-12-23/h1-9,11-16,26-31H,10,17-22H2,(H,37,38)/t26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | PLNRQTSWAZELSP-XZTOTZIXSA-N |
| XLogP | 6.38 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.78 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|