C29H43NO7 — CID 23651147
(4E,8S,9R,10E,12S,13R,14S,16S,17R)-9-hydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione (PubChem CID 23651147) has the molecular formula C29H43NO7 and a molecular weight of 517.66 g/mol. Its IUPAC name is (4E,8S,9R,10E,12S,13R,14S,16S,17R)-9-hydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione.
| Compound Name | (4E,8S,9R,10E,12S,13R,14S,16S,17R)-9-hydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione |
|---|---|
| PubChem CID | 23651147 |
| Molecular Formula | C29H43NO7 |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | (4E,8S,9R,10E,12S,13R,14S,16S,17R)-9-hydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraene-3,20,22-trione |
| SMILES | CO[C@H]1[C@@H](OC)C[C@H](C)[C@@H](OC)C2=CC(=O)C=C(NC(=O)/C(C)=C/CC[C@H](C)[C@@H](O)/C(C)=C/[C@@H]1C)C2=O |
| InChI | InChI=1S/C29H43NO7/c1-16-10-9-11-17(2)29(34)30-23-15-21(31)14-22(26(23)33)27(36-7)20(5)13-24(35-6)28(37-8)19(4)12-18(3)25(16)32/h11-12,14-16,19-20,24-25,27-28,32H,9-10,13H2,1-8H3,(H,30,34)/b17-11+,18-12+/t16-,19-,20-,24-,25+,27+,28+/m0/s1 |
| InChIKey | TYLDPBRIIHPGJA-CUKHDWGCSA-N |
| XLogP | 3.46 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|