C24H40O4SSi — CID 23652044
2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)-1-phenylsulfanylethoxy]ethoxy-triethylsilane (PubChem CID 23652044) has the molecular formula C24H40O4SSi and a molecular weight of 452.73 g/mol. Its IUPAC name is 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)-1-phenylsulfanylethoxy]ethoxy-triethylsilane.
| Compound Name | 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)-1-phenylsulfanylethoxy]ethoxy-triethylsilane |
|---|---|
| PubChem CID | 23652044 |
| Molecular Formula | C24H40O4SSi |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)-1-phenylsulfanylethoxy]ethoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCOC(CC1CCC2(CC1)OCCO2)Sc1ccccc1 |
| InChI | InChI=1S/C24H40O4SSi/c1-4-30(5-2,6-3)28-19-16-25-23(29-22-10-8-7-9-11-22)20-21-12-14-24(15-13-21)26-17-18-27-24/h7-11,21,23H,4-6,12-20H2,1-3H3 |
| InChIKey | VXWWIVDRPQZCJR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|