C24H19ClFNO4S — CID 23654792
1'-[2-(2-chloro-6-fluorophenyl)acetyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 23654792) has the molecular formula C24H19ClFNO4S and a molecular weight of 471.94 g/mol. Its IUPAC name is 1'-[2-(2-chloro-6-fluorophenyl)acetyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | 1'-[2-(2-chloro-6-fluorophenyl)acetyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 23654792 |
| Molecular Formula | C24H19ClFNO4S |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 1'-[2-(2-chloro-6-fluorophenyl)acetyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1SCC1(CCN(C(=O)Cc3c(F)cccc3Cl)CC1)O2 |
| InChI | InChI=1S/C24H19ClFNO4S/c25-17-6-3-7-18(26)16(17)12-19(28)27-10-8-24(9-11-27)13-32-23-21(30)20(29)14-4-1-2-5-15(14)22(23)31-24/h1-7H,8-13H2 |
| InChIKey | FOXWVGVISPERGB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|