C49H48N4O4 — CID 23654819
bis[(13Z)-1-(benzylideneamino)-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-yl] pentanedioate (PubChem CID 23654819) has the molecular formula C49H48N4O4 and a molecular weight of 756.95 g/mol. Its IUPAC name is bis[(13Z)-1-(benzylideneamino)-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-yl] pentanedioate.
| Compound Name | bis[(13Z)-1-(benzylideneamino)-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-yl] pentanedioate |
|---|---|
| PubChem CID | 23654819 |
| Molecular Formula | C49H48N4O4 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.37 |
| IUPAC Name | bis[(13Z)-1-(benzylideneamino)-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-yl] pentanedioate |
| SMILES | C/C=C1/C2C=C(C)CC1(/N=C/c1ccccc1)c1ccc(OC(=O)CCCC(=O)Oc3ccc4c(n3)CC3C=C(C)CC4(/N=C/c4ccccc4)/C3=C\C)nc1C2 |
| InChI | InChI=1S/C49H48N4O4/c1-5-38-36-24-32(3)28-48(38,50-30-34-14-9-7-10-15-34)40-20-22-44(52-42(40)26-36)56-46(54)18-13-19-47(55)57-45-23-21-41-43(53-45)27-37-25-33(4)29-49(41,39(37)6-2)51-31-35-16-11-8-12-17-35/h5-12,14-17,20-25,30-31,36-37H,13,18-19,26-29H2,1-4H3/b38-5-,39-6-,50-30+,51-31+ |
| InChIKey | YSDYXLHKZHNBHH-NADQOEPWSA-N |
| XLogP | 9.72 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|