C26H25N3O — CID 136636401
(1R,9R)-13-ethylidene-1-[3-(1H-indol-3-yl)prop-2-enylideneamino]-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (PubChem CID 136636401) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is (1R,9R)-13-ethylidene-1-[3-(1H-indol-3-yl)prop-2-enylideneamino]-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one.
| Compound Name | (1R,9R)-13-ethylidene-1-[3-(1H-indol-3-yl)prop-2-enylideneamino]-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
|---|---|
| PubChem CID | 136636401 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (1R,9R)-13-ethylidene-1-[3-(1H-indol-3-yl)prop-2-enylideneamino]-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| SMILES | CC=C1[C@H]2C=C(C)C[C@]1(/N=C/C=Cc1c[nH]c3ccccc13)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C26H25N3O/c1-3-21-19-13-17(2)15-26(21,22-10-11-25(30)29-24(22)14-19)28-12-6-7-18-16-27-23-9-5-4-8-20(18)23/h3-13,16,19,27H,14-15H2,1-2H3,(H,29,30)/b7-6?,21-3?,28-12+/t19-,26+/m0/s1 |
| InChIKey | XELIGWNHKQGEJM-BTQHQGDHSA-N |
| XLogP | 5.30 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|