C10H11N2O4+ — CID 23656057
3-(2,5-dimethoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 23656057) has the molecular formula C10H11N2O4+ and a molecular weight of 223.21 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 23656057 |
| Molecular Formula | C10H11N2O4+ |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(OC)c(-[n+]2cc(=O)o[nH]2)c1 |
| InChI | InChI=1S/C10H10N2O4/c1-14-7-3-4-9(15-2)8(5-7)12-6-10(13)16-11-12/h3-6H,1-2H3/p+1 |
| InChIKey | GWPCCRVBSPZULO-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|