potassium 1,1,2,2,2-pentafluoroethaneselenonate

C2F5KO3Se — CID 23662695

IUPACpotassium 1,1,2,2,2-pentafluoroethaneselenonate
SMILESO=[Se](=O)([O-])C(F)(F)C(F)(F)F.[K+]
InChIInChI=1S/C2HF5O3Se.K/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1
InChIKeyGPSYTIQQJYRTJX-UHFFFAOYSA-M
MW285.07 g/mol
LogP-3.11
Rot. Bonds1

About potassium 1,1,2,2,2-pentafluoroethaneselenonate

potassium 1,1,2,2,2-pentafluoroethaneselenonate (PubChem CID 23662695) has the molecular formula C2F5KO3Se and a molecular weight of 285.07 g/mol. Its IUPAC name is potassium 1,1,2,2,2-pentafluoroethaneselenonate.

Molecular Properties

Compound Namepotassium 1,1,2,2,2-pentafluoroethaneselenonate
PubChem CID23662695
Molecular FormulaC2F5KO3Se
Molecular Weight285.07 g/mol
Exact Mass285.86
IUPAC Namepotassium 1,1,2,2,2-pentafluoroethaneselenonate
SMILESO=[Se](=O)([O-])C(F)(F)C(F)(F)F.[K+]
InChIInChI=1S/C2HF5O3Se.K/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1
InChIKeyGPSYTIQQJYRTJX-UHFFFAOYSA-M
XLogP-3.11
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.07
LogP ≤ 5-3.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze potassium 1,1,2,2,2-pentafluoroethaneselenonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 1,1,2,2,2-pentafluoroethaneselenonate?
The IUPAC name of potassium 1,1,2,2,2-pentafluoroethaneselenonate (CID 23662695) is potassium 1,1,2,2,2-pentafluoroethaneselenonate.
What is the SMILES notation for potassium 1,1,2,2,2-pentafluoroethaneselenonate?
The canonical SMILES for potassium 1,1,2,2,2-pentafluoroethaneselenonate is O=[Se](=O)([O-])C(F)(F)C(F)(F)F.[K+].
What is the InChIKey of potassium 1,1,2,2,2-pentafluoroethaneselenonate?
The InChIKey is GPSYTIQQJYRTJX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2HF5O3Se.K/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1.
What are the key properties of potassium 1,1,2,2,2-pentafluoroethaneselenonate?
potassium 1,1,2,2,2-pentafluoroethaneselenonate has a molecular weight of 285.07 g/mol, XLogP of -3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1,1,2,2,2-pentafluoroethaneselenonate is sourced from PubChem (CID 23662695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).