C2F5KO3Se — CID 23662695
potassium 1,1,2,2,2-pentafluoroethaneselenonate (PubChem CID 23662695) has the molecular formula C2F5KO3Se and a molecular weight of 285.07 g/mol. Its IUPAC name is potassium 1,1,2,2,2-pentafluoroethaneselenonate.
| Compound Name | potassium 1,1,2,2,2-pentafluoroethaneselenonate |
|---|---|
| PubChem CID | 23662695 |
| Molecular Formula | C2F5KO3Se |
| Molecular Weight | 285.07 g/mol |
| Exact Mass | 285.86 |
| IUPAC Name | potassium 1,1,2,2,2-pentafluoroethaneselenonate |
| SMILES | O=[Se](=O)([O-])C(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C2HF5O3Se.K/c3-1(4,5)2(6,7)11(8,9)10;/h(H,8,9,10);/q;+1/p-1 |
| InChIKey | GPSYTIQQJYRTJX-UHFFFAOYSA-M |
| XLogP | -3.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.07 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|