C14H17N6O2RbS — CID 23665361
[4-(dimethylaminodiazenyl)phenyl]sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide;rubidium(1+) (PubChem CID 23665361) has the molecular formula C14H17N6O2RbS and a molecular weight of 418.87 g/mol. Its IUPAC name is [4-(dimethylaminodiazenyl)phenyl]sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide;rubidium(1+).
| Compound Name | [4-(dimethylaminodiazenyl)phenyl]sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide;rubidium(1+) |
|---|---|
| PubChem CID | 23665361 |
| Molecular Formula | C14H17N6O2RbS |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [4-(dimethylaminodiazenyl)phenyl]sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide;rubidium(1+) |
| SMILES | Cc1cc(C)nc([N-]S(=O)(=O)c2ccc(/N=N/N(C)C)cc2)n1.[Rb+] |
| InChI | InChI=1S/C14H17N6O2S.Rb/c1-10-9-11(2)16-14(15-10)18-23(21,22)13-7-5-12(6-8-13)17-19-20(3)4;/h5-9H,1-4H3;/q-1;+1/b19-17+; |
| InChIKey | SLWJYSDXPZRPIM-ZJSKVYKZSA-N |
| XLogP | 0.05 |
| TPSA | 101.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|