C12H17KN4O3S — CID 56642968
potassium (1E)-N-[4-(dimethylaminodiazenyl)phenyl]sulfonylbutanimidate (PubChem CID 56642968) has the molecular formula C12H17KN4O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is potassium (1E)-N-[4-(dimethylaminodiazenyl)phenyl]sulfonylbutanimidate.
| Compound Name | potassium (1E)-N-[4-(dimethylaminodiazenyl)phenyl]sulfonylbutanimidate |
|---|---|
| PubChem CID | 56642968 |
| Molecular Formula | C12H17KN4O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | potassium (1E)-N-[4-(dimethylaminodiazenyl)phenyl]sulfonylbutanimidate |
| SMILES | CCC/C([O-])=N\S(=O)(=O)c1ccc(/N=N/N(C)C)cc1.[K+] |
| InChI | InChI=1S/C12H18N4O3S.K/c1-4-5-12(17)14-20(18,19)11-8-6-10(7-9-11)13-15-16(2)3;/h6-9H,4-5H2,1-3H3,(H,14,17);/q;+1/p-1/b15-13+; |
| InChIKey | HPLXIKKNZAPAJN-GVYCEHEKSA-M |
| XLogP | -1.50 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|