C8H9KO — CID 23677781
potassium 2,4-dimethylphenolate (PubChem CID 23677781) has the molecular formula C8H9KO and a molecular weight of 160.26 g/mol. Its IUPAC name is potassium 2,4-dimethylphenolate.
| Compound Name | potassium 2,4-dimethylphenolate |
|---|---|
| PubChem CID | 23677781 |
| Molecular Formula | C8H9KO |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | potassium 2,4-dimethylphenolate |
| SMILES | Cc1ccc([O-])c(C)c1.[K+] |
| InChI | InChI=1S/C8H10O.K/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3;/q;+1/p-1 |
| InChIKey | FSQXNZZDWLFDTA-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |