C19H20N3NaO5S — CID 23714074
sodium 4-[[4-[4-(prop-2-enoylamino)butoxy]phenyl]diazenyl]benzenesulfonate (PubChem CID 23714074) has the molecular formula C19H20N3NaO5S and a molecular weight of 425.44 g/mol. Its IUPAC name is sodium 4-[[4-[4-(prop-2-enoylamino)butoxy]phenyl]diazenyl]benzenesulfonate.
| Compound Name | sodium 4-[[4-[4-(prop-2-enoylamino)butoxy]phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 23714074 |
| Molecular Formula | C19H20N3NaO5S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | sodium 4-[[4-[4-(prop-2-enoylamino)butoxy]phenyl]diazenyl]benzenesulfonate |
| SMILES | C=CC(=O)NCCCCOc1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C19H21N3O5S.Na/c1-2-19(23)20-13-3-4-14-27-17-9-5-15(6-10-17)21-22-16-7-11-18(12-8-16)28(24,25)26;/h2,5-12H,1,3-4,13-14H2,(H,20,23)(H,24,25,26);/q;+1/p-1/b22-21+; |
| InChIKey | AIYPDUGYUFHHMT-QUABFQRHSA-M |
| XLogP | 0.47 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|