C23H31N2NaO6 — CID 23714078
sodium 2-[4-(prop-2-enoylamino)butoxy]-3-[4-[4-(prop-2-enoylamino)butoxy]phenyl]propanoate (PubChem CID 23714078) has the molecular formula C23H31N2NaO6 and a molecular weight of 454.50 g/mol. Its IUPAC name is sodium 2-[4-(prop-2-enoylamino)butoxy]-3-[4-[4-(prop-2-enoylamino)butoxy]phenyl]propanoate.
| Compound Name | sodium 2-[4-(prop-2-enoylamino)butoxy]-3-[4-[4-(prop-2-enoylamino)butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 23714078 |
| Molecular Formula | C23H31N2NaO6 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | sodium 2-[4-(prop-2-enoylamino)butoxy]-3-[4-[4-(prop-2-enoylamino)butoxy]phenyl]propanoate |
| SMILES | C=CC(=O)NCCCCOc1ccc(CC(OCCCCNC(=O)C=C)C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C23H32N2O6.Na/c1-3-21(26)24-13-5-7-15-30-19-11-9-18(10-12-19)17-20(23(28)29)31-16-8-6-14-25-22(27)4-2;/h3-4,9-12,20H,1-2,5-8,13-17H2,(H,24,26)(H,25,27)(H,28,29);/q;+1/p-1 |
| InChIKey | DVODKUFMJGYSPP-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|