C30H39N3O9 — CID 23726665
triethyl 6,12,18-tris(methoxymethyl)-4,10,16-triazatetracyclo[13.3.0.03,7.09,13]octadeca-1(15),3(7),5,9(13),11,17-hexaene-5,11,17-tricarboxylate (PubChem CID 23726665) has the molecular formula C30H39N3O9 and a molecular weight of 585.65 g/mol. Its IUPAC name is triethyl 6,12,18-tris(methoxymethyl)-4,10,16-triazatetracyclo[13.3.0.03,7.09,13]octadeca-1(15),3(7),5,9(13),11,17-hexaene-5,11,17-tricarboxylate.
| Compound Name | triethyl 6,12,18-tris(methoxymethyl)-4,10,16-triazatetracyclo[13.3.0.03,7.09,13]octadeca-1(15),3(7),5,9(13),11,17-hexaene-5,11,17-tricarboxylate |
|---|---|
| PubChem CID | 23726665 |
| Molecular Formula | C30H39N3O9 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | triethyl 6,12,18-tris(methoxymethyl)-4,10,16-triazatetracyclo[13.3.0.03,7.09,13]octadeca-1(15),3(7),5,9(13),11,17-hexaene-5,11,17-tricarboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(c1COC)Cc1[nH]c(C(=O)OCC)c(COC)c1Cc1[nH]c(C(=O)OCC)c(COC)c1C2 |
| InChI | InChI=1S/C30H39N3O9/c1-7-40-28(34)25-19(13-37-4)16-10-23-18(21(15-39-6)27(32-23)30(36)42-9-3)12-24-17(11-22(16)31-25)20(14-38-5)26(33-24)29(35)41-8-2/h31-33H,7-15H2,1-6H3 |
| InChIKey | FIBXBXGMVOOHCQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|