C13H21NO3 — CID 70641710
butyl 4-(methoxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 70641710) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is butyl 4-(methoxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | butyl 4-(methoxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 70641710 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | butyl 4-(methoxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCCCOC(=O)c1[nH]c(C)c(COC)c1C |
| InChI | InChI=1S/C13H21NO3/c1-5-6-7-17-13(15)12-9(2)11(8-16-4)10(3)14-12/h14H,5-8H2,1-4H3 |
| InChIKey | FYMNOPPJTHOGKG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|