C18H22O8S — CID 23726730
dimethyl 2-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]propanedioate (PubChem CID 23726730) has the molecular formula C18H22O8S and a molecular weight of 398.43 g/mol. Its IUPAC name is dimethyl 2-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]propanedioate.
| Compound Name | dimethyl 2-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]propanedioate |
|---|---|
| PubChem CID | 23726730 |
| Molecular Formula | C18H22O8S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | dimethyl 2-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1[C@H](OC)O[C@@H]2C[C@@]21S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22O8S/c1-10-5-7-11(8-6-10)27(21,22)18-9-12(18)26-17(25-4)14(18)13(15(19)23-2)16(20)24-3/h5-8,12-14,17H,9H2,1-4H3/t12-,14+,17-,18-/m1/s1 |
| InChIKey | XFBSHLLGWMEFKF-KBEZCGTCSA-N |
| XLogP | 0.86 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|