C20H21F4N2O3+ — CID 2373131
(4-benzylpiperazin-4-ium-1-yl)-[2,4-bis(difluoromethoxy)phenyl]methanone (PubChem CID 2373131) has the molecular formula C20H21F4N2O3+ and a molecular weight of 413.39 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-[2,4-bis(difluoromethoxy)phenyl]methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-[2,4-bis(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 2373131 |
| Molecular Formula | C20H21F4N2O3+ |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-[2,4-bis(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)F)cc1OC(F)F)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20F4N2O3/c21-19(22)28-15-6-7-16(17(12-15)29-20(23)24)18(27)26-10-8-25(9-11-26)13-14-4-2-1-3-5-14/h1-7,12,19-20H,8-11,13H2/p+1 |
| InChIKey | WEOSTYULMHJRCT-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |