C16H11N3O2 — CID 23736880
N-(3-cyanofuro[3,2-b]pyridin-2-yl)-4-methylbenzamide (PubChem CID 23736880) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(3-cyanofuro[3,2-b]pyridin-2-yl)-4-methylbenzamide.
| Compound Name | N-(3-cyanofuro[3,2-b]pyridin-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 23736880 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(3-cyanofuro[3,2-b]pyridin-2-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2oc3cccnc3c2C#N)cc1 |
| InChI | InChI=1S/C16H11N3O2/c1-10-4-6-11(7-5-10)15(20)19-16-12(9-17)14-13(21-16)3-2-8-18-14/h2-8H,1H3,(H,19,20) |
| InChIKey | LYVNXWLEVLXPFE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |