C23H34N2OS — CID 23742184
N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide (PubChem CID 23742184) has the molecular formula C23H34N2OS and a molecular weight of 386.61 g/mol. Its IUPAC name is N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 23742184 |
| Molecular Formula | C23H34N2OS |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1nc(CC23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C23H34N2OS/c26-21(7-6-16-4-2-1-3-5-16)25-22-24-20(15-27-22)14-23-11-17-8-18(12-23)10-19(9-17)13-23/h15-19H,1-14H2,(H,24,25,26) |
| InChIKey | JNUBWSWAKYDRLO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |