C26H28N2O2S — CID 23761117
N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide (PubChem CID 23761117) has the molecular formula C26H28N2O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 23761117 |
| Molecular Formula | C26H28N2O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[4-(1-adamantylmethyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1nc(CC23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C26H28N2O2S/c29-24(15-30-23-6-5-20-3-1-2-4-21(20)10-23)28-25-27-22(16-31-25)14-26-11-17-7-18(12-26)9-19(8-17)13-26/h1-6,10,16-19H,7-9,11-15H2,(H,27,28,29) |
| InChIKey | XLLNZDBONFUOFV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |