C30H28N6O4S2 — CID 23742622
2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 23742622) has the molecular formula C30H28N6O4S2 and a molecular weight of 600.73 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23742622 |
| Molecular Formula | C30H28N6O4S2 |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nnc(N3C(N)=C(C#N)C(/C=C/c4ccccc4)C4=C3CCCC4=O)s2)c1 |
| InChI | InChI=1S/C30H28N6O4S2/c1-39-19-12-14-25(40-2)22(15-19)33-26(38)17-41-30-35-34-29(42-30)36-23-9-6-10-24(37)27(23)20(21(16-31)28(36)32)13-11-18-7-4-3-5-8-18/h3-5,7-8,11-15,20H,6,9-10,17,32H2,1-2H3,(H,33,38)/b13-11+ |
| InChIKey | JUCFXRWOHYULDO-ACCUITESSA-N |
| XLogP | 5.14 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |