C29H25FN6O2S2 — CID 23997546
2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 23997546) has the molecular formula C29H25FN6O2S2 and a molecular weight of 572.69 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 23997546 |
| Molecular Formula | C29H25FN6O2S2 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-5-oxo-4-[(E)-2-phenylethenyl]-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CSc1nnc(N2C(N)=C(C#N)C(/C=C/c3ccccc3)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C29H25FN6O2S2/c1-17-10-12-19(30)14-22(17)33-25(38)16-39-29-35-34-28(40-29)36-23-8-5-9-24(37)26(23)20(21(15-31)27(36)32)13-11-18-6-3-2-4-7-18/h2-4,6-7,10-14,20H,5,8-9,16,32H2,1H3,(H,33,38)/b13-11+ |
| InChIKey | XTFZJHMHOKTHBC-ACCUITESSA-N |
| XLogP | 5.57 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |