C14H21N4S+ — CID 2374627
benzyl-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-propan-2-ylazanium (PubChem CID 2374627) has the molecular formula C14H21N4S+ and a molecular weight of 277.42 g/mol. Its IUPAC name is benzyl-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-propan-2-ylazanium.
| Compound Name | benzyl-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 2374627 |
| Molecular Formula | C14H21N4S+ |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | benzyl-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH+](Cc1ccccc1)Cn1ncn(C)c1=S |
| InChI | InChI=1S/C14H20N4S/c1-12(2)17(9-13-7-5-4-6-8-13)11-18-14(19)16(3)10-15-18/h4-8,10,12H,9,11H2,1-3H3/p+1 |
| InChIKey | OARRYJQOUNMMEH-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|