C19H15F3N4O2S — CID 2389164
[4-(difluoromethoxy)phenyl]-[(6R,7R)-6-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 2389164) has the molecular formula C19H15F3N4O2S and a molecular weight of 420.42 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]-[(6R,7R)-6-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | [4-(difluoromethoxy)phenyl]-[(6R,7R)-6-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 2389164 |
| Molecular Formula | C19H15F3N4O2S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]-[(6R,7R)-6-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | Cc1nnc2n1N[C@H](c1ccccc1F)[C@H](C(=O)c1ccc(OC(F)F)cc1)S2 |
| InChI | InChI=1S/C19H15F3N4O2S/c1-10-23-24-19-26(10)25-15(13-4-2-3-5-14(13)20)17(29-19)16(27)11-6-8-12(9-7-11)28-18(21)22/h2-9,15,17-18,25H,1H3/t15-,17-/m1/s1 |
| InChIKey | GDFCYRIAGFILFW-NVXWUHKLSA-N |
| XLogP | 3.97 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |