C16H23NO6 — CID 23920841
(E,6S,7S)-N,7-dihydroxy-7-[2-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enamide (PubChem CID 23920841) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is (E,6S,7S)-N,7-dihydroxy-7-[2-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enamide.
| Compound Name | (E,6S,7S)-N,7-dihydroxy-7-[2-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enamide |
|---|---|
| PubChem CID | 23920841 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (E,6S,7S)-N,7-dihydroxy-7-[2-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enamide |
| SMILES | CO[C@@H](CC/C=C/C(=O)NO)[C@@H](O)c1ccccc1OCCO |
| InChI | InChI=1S/C16H23NO6/c1-22-14(8-4-5-9-15(19)17-21)16(20)12-6-2-3-7-13(12)23-11-10-18/h2-3,5-7,9,14,16,18,20-21H,4,8,10-11H2,1H3,(H,17,19)/b9-5+/t14-,16-/m0/s1 |
| InChIKey | OQDKGESXQWWWGL-QVDQZQSHSA-N |
| XLogP | 0.95 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|