C28H37N2O2P — CID 23993256
N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]naphthalen-1-amine (PubChem CID 23993256) has the molecular formula C28H37N2O2P and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]naphthalen-1-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]naphthalen-1-amine |
|---|---|
| PubChem CID | 23993256 |
| Molecular Formula | C28H37N2O2P |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]naphthalen-1-amine |
| SMILES | CC1CCC(C(C)C)C(OP(=O)(Nc2cccc3ccccc23)c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C28H37N2O2P/c1-20(2)25-18-13-21(3)19-28(25)32-33(31,24-16-14-23(15-17-24)30(4)5)29-27-12-8-10-22-9-6-7-11-26(22)27/h6-12,14-17,20-21,25,28H,13,18-19H2,1-5H3,(H,29,31) |
| InChIKey | RSPFZCJUFQAEJG-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|