C25H34F3N2O2P — CID 3770214
N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]-3-(trifluoromethyl)aniline (PubChem CID 3770214) has the molecular formula C25H34F3N2O2P and a molecular weight of 482.53 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3770214 |
| Molecular Formula | C25H34F3N2O2P |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]-3-(trifluoromethyl)aniline |
| SMILES | CC1CCC(C(C)C)C(OP(=O)(Nc2cccc(C(F)(F)F)c2)c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C25H34F3N2O2P/c1-17(2)23-14-9-18(3)15-24(23)32-33(31,22-12-10-21(11-13-22)30(4)5)29-20-8-6-7-19(16-20)25(26,27)28/h6-8,10-13,16-18,23-24H,9,14-15H2,1-5H3,(H,29,31) |
| InChIKey | UBPSAZCRGIFMOO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|