C19H20N4O6S — CID 2436592
4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 2436592) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2436592 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2cc(OC)ccc2OC)n1N=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H20N4O6S/c1-26-9-8-20-19-22(21-11-14-5-7-18(29-14)23(24)25)16(12-30-19)15-10-13(27-2)4-6-17(15)28-3/h4-7,10-12H,8-9H2,1-3H3/b20-19-,21-11? |
| InChIKey | YVOQRFXVMNHYFA-PCSFFSRSSA-N |
| XLogP | 3.16 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|