C16H14BrN3O2S — CID 24533035
4-bromo-1-methyl-N'-(3-methyl-1-benzothiophene-2-carbonyl)pyrrole-2-carbohydrazide (PubChem CID 24533035) has the molecular formula C16H14BrN3O2S and a molecular weight of 392.28 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-(3-methyl-1-benzothiophene-2-carbonyl)pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-(3-methyl-1-benzothiophene-2-carbonyl)pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 24533035 |
| Molecular Formula | C16H14BrN3O2S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 4-bromo-1-methyl-N'-(3-methyl-1-benzothiophene-2-carbonyl)pyrrole-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cc(Br)cn2C)sc2ccccc12 |
| InChI | InChI=1S/C16H14BrN3O2S/c1-9-11-5-3-4-6-13(11)23-14(9)16(22)19-18-15(21)12-7-10(17)8-20(12)2/h3-8H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | SEHGCNNXRHWBEZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|