C21H25N3O6S — CID 24535146
methyl 2-methyl-5-[(E)-3-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-3-oxoprop-1-enyl]furan-3-carboxylate (PubChem CID 24535146) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is methyl 2-methyl-5-[(E)-3-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-3-oxoprop-1-enyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(E)-3-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-3-oxoprop-1-enyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 24535146 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | methyl 2-methyl-5-[(E)-3-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-3-oxoprop-1-enyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(/C=C/C(=O)Nc2ccc(S(=O)(=O)N3CCN(C)CC3)cc2)oc1C |
| InChI | InChI=1S/C21H25N3O6S/c1-15-19(21(26)29-3)14-17(30-15)6-9-20(25)22-16-4-7-18(8-5-16)31(27,28)24-12-10-23(2)11-13-24/h4-9,14H,10-13H2,1-3H3,(H,22,25)/b9-6+ |
| InChIKey | UXZAPUYXYJILAN-RMKNXTFCSA-N |
| XLogP | 1.96 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|