C23H28N4O5 — CID 24609588
3-methoxy-4-(3-methylbutoxy)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]benzohydrazide (PubChem CID 24609588) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-methoxy-4-(3-methylbutoxy)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]benzohydrazide.
| Compound Name | 3-methoxy-4-(3-methylbutoxy)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24609588 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-methoxy-4-(3-methylbutoxy)-N'-[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)Cn2c(=O)n(C)c3ccccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C23H28N4O5/c1-15(2)11-12-32-19-10-9-16(13-20(19)31-4)22(29)25-24-21(28)14-27-18-8-6-5-7-17(18)26(3)23(27)30/h5-10,13,15H,11-12,14H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | SBYUBEPCFDWXFL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|