C21H24N4O4 — CID 24634750
3-(3,4-dimethoxyphenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]propanehydrazide (PubChem CID 24634750) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]propanehydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 24634750 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]propanehydrazide |
| SMILES | COc1ccc(CCC(=O)NNC(=O)Cc2nc3ccccc3n2C)cc1OC |
| InChI | InChI=1S/C21H24N4O4/c1-25-16-7-5-4-6-15(16)22-19(25)13-21(27)24-23-20(26)11-9-14-8-10-17(28-2)18(12-14)29-3/h4-8,10,12H,9,11,13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | PXPUYYKUQXLDAP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|