C18H22FN3O4S2 — CID 24642957
N-[4-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]-4-fluorobenzenesulfonamide (PubChem CID 24642957) has the molecular formula C18H22FN3O4S2 and a molecular weight of 427.52 g/mol. Its IUPAC name is N-[4-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 24642957 |
| Molecular Formula | C18H22FN3O4S2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[4-[2-(5-ethyl-4-methylthiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]-4-fluorobenzenesulfonamide |
| SMILES | CCc1sc(C(=O)NNC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H22FN3O4S2/c1-3-15-12(2)11-16(27-15)18(24)22-21-17(23)5-4-10-20-28(25,26)14-8-6-13(19)7-9-14/h6-9,11,20H,3-5,10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | LAYWGMPOMLHHOV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|