C18H17ClN4O4S2 — CID 24682062
3-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 24682062) has the molecular formula C18H17ClN4O4S2 and a molecular weight of 452.95 g/mol. Its IUPAC name is 3-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 3-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 24682062 |
| Molecular Formula | C18H17ClN4O4S2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 3-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C18H17ClN4O4S2/c19-15-5-6-17(28-15)29(26,27)23-9-7-21(8-10-23)16(24)11-22-12-20-14-4-2-1-3-13(14)18(22)25/h1-6,12H,7-11H2 |
| InChIKey | WTJDQKIMSIQJJL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |