C8H9N3O2 — CID 24699332
4-(3,6-dioxo-1H-pyridazin-2-yl)butanenitrile (PubChem CID 24699332) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 4-(3,6-dioxo-1H-pyridazin-2-yl)butanenitrile.
| Compound Name | 4-(3,6-dioxo-1H-pyridazin-2-yl)butanenitrile |
|---|---|
| PubChem CID | 24699332 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-(3,6-dioxo-1H-pyridazin-2-yl)butanenitrile |
| SMILES | N#CCCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C8H9N3O2/c9-5-1-2-6-11-8(13)4-3-7(12)10-11/h3-4H,1-2,6H2,(H,10,12) |
| InChIKey | DAPZDLIHANPCFY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|