C18H20OS2 — CID 2470453
(2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one (PubChem CID 2470453) has the molecular formula C18H20OS2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one.
| Compound Name | (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one |
|---|---|
| PubChem CID | 2470453 |
| Molecular Formula | C18H20OS2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one |
| SMILES | O=C1C(=C2SCCCS2)CCC[C@@]12C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C18H20OS2/c19-16-14(17-20-10-5-11-21-17)8-4-9-18(16)12-15(18)13-6-2-1-3-7-13/h1-3,6-7,15H,4-5,8-12H2/t15-,18-/m0/s1 |
| InChIKey | PQZUCECXZRDHCJ-YJBOKZPZSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|