About (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one
(2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one (PubChem CID 2470453) has the molecular formula C18H20OS2
and a molecular weight of 316.49 g/mol. Its IUPAC name is (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one.
Molecular Properties
| Compound Name | (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one |
| PubChem CID | 2470453 |
| Molecular Formula | C18H20OS2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one |
| SMILES | O=C1C(=C2SCCCS2)CCC[C@@]12C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C18H20OS2/c19-16-14(17-20-10-5-11-21-17)8-4-9-18(16)12-15(18)13-6-2-1-3-7-13/h1-3,6-7,15H,4-5,8-12H2/t15-,18-/m0/s1 |
| InChIKey | PQZUCECXZRDHCJ-YJBOKZPZSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one?
The IUPAC name of (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one (CID 2470453) is (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one.
What is the SMILES notation for (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one?
The canonical SMILES for (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one is O=C1C(=C2SCCCS2)CCC[C@@]12C[C@H]2c1ccccc1.
What is the InChIKey of (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one?
The InChIKey is PQZUCECXZRDHCJ-YJBOKZPZSA-N. The full InChI is InChI=1S/C18H20OS2/c19-16-14(17-20-10-5-11-21-17)8-4-9-18(16)12-15(18)13-6-2-1-3-7-13/h1-3,6-7,15H,4-5,8-12H2/t15-,18-/m0/s1.
What are the key properties of (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one?
(2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one has a molecular weight of 316.49 g/mol, XLogP of 4.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-7-(1,3-dithian-2-ylidene)-2-phenylspiro[2.5]octan-8-one is sourced from PubChem (CID 2470453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).