C19H18O3S2 — CID 42611612
7-(1,3-dithiolan-2-ylidene)-10-phenylspiro[4.5]decane-1,4,8-trione (PubChem CID 42611612) has the molecular formula C19H18O3S2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 7-(1,3-dithiolan-2-ylidene)-10-phenylspiro[4.5]decane-1,4,8-trione.
| Compound Name | 7-(1,3-dithiolan-2-ylidene)-10-phenylspiro[4.5]decane-1,4,8-trione |
|---|---|
| PubChem CID | 42611612 |
| Molecular Formula | C19H18O3S2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 7-(1,3-dithiolan-2-ylidene)-10-phenylspiro[4.5]decane-1,4,8-trione |
| SMILES | O=C1CC(c2ccccc2)C2(CC1=C1SCCS1)C(=O)CCC2=O |
| InChI | InChI=1S/C19H18O3S2/c20-15-10-14(12-4-2-1-3-5-12)19(16(21)6-7-17(19)22)11-13(15)18-23-8-9-24-18/h1-5,14H,6-11H2 |
| InChIKey | SQTJDTRJXFPKKG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|