C22H23NO5S2 — CID 42611410
8-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione (PubChem CID 42611410) has the molecular formula C22H23NO5S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is 8-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione.
| Compound Name | 8-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 42611410 |
| Molecular Formula | C22H23NO5S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 8-(1,3-dithiolan-2-ylidene)-3,3-dimethyl-11-(4-nitrophenyl)spiro[5.5]undecane-1,5,9-trione |
| SMILES | CC1(C)CC(=O)C2(CC(=C3SCCS3)C(=O)CC2c2ccc([N+](=O)[O-])cc2)C(=O)C1 |
| InChI | InChI=1S/C22H23NO5S2/c1-21(2)11-18(25)22(19(26)12-21)10-15(20-29-7-8-30-20)17(24)9-16(22)13-3-5-14(6-4-13)23(27)28/h3-6,16H,7-12H2,1-2H3 |
| InChIKey | IOGWTFCXKKFTRK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|