C18H18N2O4S2 — CID 24737527
2-(3-methylsulfonylphenyl)sulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]indole (PubChem CID 24737527) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(3-methylsulfonylphenyl)sulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]indole.
| Compound Name | 2-(3-methylsulfonylphenyl)sulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 24737527 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(3-methylsulfonylphenyl)sulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]indole |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCn3c(cc4ccccc43)C2)c1 |
| InChI | InChI=1S/C18H18N2O4S2/c1-25(21,22)16-6-4-7-17(12-16)26(23,24)19-9-10-20-15(13-19)11-14-5-2-3-8-18(14)20/h2-8,11-12H,9-10,13H2,1H3 |
| InChIKey | BIKWZRVKGTZEFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |