C18H38N4S2 — CID 24741614
3-[12-(dimethylcarbamothioylamino)dodecyl]-1,1-dimethylthiourea (PubChem CID 24741614) has the molecular formula C18H38N4S2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 3-[12-(dimethylcarbamothioylamino)dodecyl]-1,1-dimethylthiourea.
| Compound Name | 3-[12-(dimethylcarbamothioylamino)dodecyl]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 24741614 |
| Molecular Formula | C18H38N4S2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 3-[12-(dimethylcarbamothioylamino)dodecyl]-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NCCCCCCCCCCCCNC(=S)N(C)C |
| InChI | InChI=1S/C18H38N4S2/c1-21(2)17(23)19-15-13-11-9-7-5-6-8-10-12-14-16-20-18(24)22(3)4/h5-16H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | YQGXJGSGNGYOIP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|