C7H12N4O2 — CID 24754589
(3S,5R)-7-azido-3,5-dihydroxyheptanenitrile (PubChem CID 24754589) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is (3S,5R)-7-azido-3,5-dihydroxyheptanenitrile.
| Compound Name | (3S,5R)-7-azido-3,5-dihydroxyheptanenitrile |
|---|---|
| PubChem CID | 24754589 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (3S,5R)-7-azido-3,5-dihydroxyheptanenitrile |
| SMILES | N#CC[C@H](O)C[C@H](O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C7H12N4O2/c8-3-1-6(12)5-7(13)2-4-10-11-9/h6-7,12-13H,1-2,4-5H2/t6-,7+/m0/s1 |
| InChIKey | SPGNNNHBYXXBEH-NKWVEPMBSA-N |
| XLogP | 0.71 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|