C27H47N2O8P — CID 24756311
[(2R,3S,5R)-2-(dioctoxyphosphanyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 24756311) has the molecular formula C27H47N2O8P and a molecular weight of 558.65 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(dioctoxyphosphanyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2-(dioctoxyphosphanyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 24756311 |
| Molecular Formula | C27H47N2O8P |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [(2R,3S,5R)-2-(dioctoxyphosphanyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CCCCCCCCOP(OCCCCCCCC)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H47N2O8P/c1-4-6-8-10-12-14-18-33-38(34-19-15-13-11-9-7-5-2)35-21-24-23(36-22(3)30)20-26(37-24)29-17-16-25(31)28-27(29)32/h16-17,23-24,26H,4-15,18-21H2,1-3H3,(H,28,31,32)/t23-,24+,26+/m0/s1 |
| InChIKey | SXKSQXYIJDZXLW-BFLUCZKCSA-N |
| XLogP | 5.75 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|