C18H20N2O2S — CID 2475886
furan-2-yl-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone (PubChem CID 2475886) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is furan-2-yl-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone.
| Compound Name | furan-2-yl-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 2475886 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | furan-2-yl-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone |
| SMILES | CC(C)c1ccccc1/N=C1\SCCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C18H20N2O2S/c1-13(2)14-7-3-4-8-15(14)19-18-20(10-6-12-23-18)17(21)16-9-5-11-22-16/h3-5,7-9,11,13H,6,10,12H2,1-2H3/b19-18- |
| InChIKey | NMEMEHVGGOVBHQ-HNENSFHCSA-N |
| XLogP | 4.67 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|